C11H16F3N5O — CID 129433840
1-[(3S)-hex-5-en-3-yl]-3-[[3-(trifluoromethyl)-1H-1,2,4-triazol-5-yl]methyl]urea (PubChem CID 129433840) has the molecular formula C11H16F3N5O and a molecular weight of 291.28 g/mol. Its IUPAC name is 1-[(3S)-hex-5-en-3-yl]-3-[[3-(trifluoromethyl)-1H-1,2,4-triazol-5-yl]methyl]urea.
| Compound Name | 1-[(3S)-hex-5-en-3-yl]-3-[[3-(trifluoromethyl)-1H-1,2,4-triazol-5-yl]methyl]urea |
|---|---|
| PubChem CID | 129433840 |
| Molecular Formula | C11H16F3N5O |
| Molecular Weight | 291.28 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | 1-[(3S)-hex-5-en-3-yl]-3-[[3-(trifluoromethyl)-1H-1,2,4-triazol-5-yl]methyl]urea |
| SMILES | C=CC[C@H](CC)NC(=O)NCc1nc(C(F)(F)F)n[nH]1 |
| InChI | InChI=1S/C11H16F3N5O/c1-3-5-7(4-2)16-10(20)15-6-8-17-9(19-18-8)11(12,13)14/h3,7H,1,4-6H2,2H3,(H2,15,16,20)(H,17,18,19)/t7-/m0/s1 |
| InChIKey | UEFQVHSVAGMTSY-ZETCQYMHSA-N |
| XLogP | 1.98 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.28 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|