C12H22N4 — CID 104583652
N-[1-(5-ethyl-1H-1,2,4-triazol-3-yl)ethyl]hex-5-en-2-amine (PubChem CID 104583652) has the molecular formula C12H22N4 and a molecular weight of 222.34 g/mol. Its IUPAC name is N-[1-(5-ethyl-1H-1,2,4-triazol-3-yl)ethyl]hex-5-en-2-amine.
| Compound Name | N-[1-(5-ethyl-1H-1,2,4-triazol-3-yl)ethyl]hex-5-en-2-amine |
|---|---|
| PubChem CID | 104583652 |
| Molecular Formula | C12H22N4 |
| Molecular Weight | 222.34 g/mol |
| Exact Mass | 222.18 |
| IUPAC Name | N-[1-(5-ethyl-1H-1,2,4-triazol-3-yl)ethyl]hex-5-en-2-amine |
| SMILES | C=CCCC(C)NC(C)c1n[nH]c(CC)n1 |
| InChI | InChI=1S/C12H22N4/c1-5-7-8-9(3)13-10(4)12-14-11(6-2)15-16-12/h5,9-10,13H,1,6-8H2,2-4H3,(H,14,15,16) |
| InChIKey | SKPZWXHANUWOEY-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.34 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|