C8H15N5 — CID 123972560
5-(1-amino-3-methylpent-4-enyl)-1H-1,2,4-triazol-3-amine (PubChem CID 123972560) has the molecular formula C8H15N5 and a molecular weight of 181.24 g/mol. Its IUPAC name is 5-(1-amino-3-methylpent-4-enyl)-1H-1,2,4-triazol-3-amine.
| Compound Name | 5-(1-amino-3-methylpent-4-enyl)-1H-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 123972560 |
| Molecular Formula | C8H15N5 |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.13 |
| IUPAC Name | 5-(1-amino-3-methylpent-4-enyl)-1H-1,2,4-triazol-3-amine |
| SMILES | C=CC(C)CC(N)c1nc(N)n[nH]1 |
| InChI | InChI=1S/C8H15N5/c1-3-5(2)4-6(9)7-11-8(10)13-12-7/h3,5-6H,1,4,9H2,2H3,(H3,10,11,12,13) |
| InChIKey | MAMAOEPAYJZLPV-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 93.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|