C13H24N4 — CID 163878218
(Z)-4-(5-methyl-1H-1,2,4-triazol-3-yl)dec-7-en-1-amine (PubChem CID 163878218) has the molecular formula C13H24N4 and a molecular weight of 236.36 g/mol. Its IUPAC name is (Z)-4-(5-methyl-1H-1,2,4-triazol-3-yl)dec-7-en-1-amine.
| Compound Name | (Z)-4-(5-methyl-1H-1,2,4-triazol-3-yl)dec-7-en-1-amine |
|---|---|
| PubChem CID | 163878218 |
| Molecular Formula | C13H24N4 |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.20 |
| IUPAC Name | (Z)-4-(5-methyl-1H-1,2,4-triazol-3-yl)dec-7-en-1-amine |
| SMILES | CC/C=C\CCC(CCCN)c1n[nH]c(C)n1 |
| InChI | InChI=1S/C13H24N4/c1-3-4-5-6-8-12(9-7-10-14)13-15-11(2)16-17-13/h4-5,12H,3,6-10,14H2,1-2H3,(H,15,16,17)/b5-4- |
| InChIKey | PQTVYAPKTWBPDA-PLNGDYQASA-N |
| XLogP | 2.68 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|