C9H13N3 — CID 142256716
5-cyclohept-4-en-1-yl-1H-1,2,4-triazole (PubChem CID 142256716) has the molecular formula C9H13N3 and a molecular weight of 163.22 g/mol. Its IUPAC name is 5-cyclohept-4-en-1-yl-1H-1,2,4-triazole.
| Compound Name | 5-cyclohept-4-en-1-yl-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 142256716 |
| Molecular Formula | C9H13N3 |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.11 |
| IUPAC Name | 5-cyclohept-4-en-1-yl-1H-1,2,4-triazole |
| SMILES | C1=CCCC(c2ncn[nH]2)CC1 |
| InChI | InChI=1S/C9H13N3/c1-2-4-6-8(5-3-1)9-10-7-11-12-9/h1-2,7-8H,3-6H2,(H,10,11,12) |
| InChIKey | ZPWSTRKPJLRJCX-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|