C20H37N3 — CID 67896261
5-[(Z)-octadec-9-enyl]-1H-1,2,4-triazole (PubChem CID 67896261) has the molecular formula C20H37N3 and a molecular weight of 319.54 g/mol. Its IUPAC name is 5-[(Z)-octadec-9-enyl]-1H-1,2,4-triazole.
| Compound Name | 5-[(Z)-octadec-9-enyl]-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 67896261 |
| Molecular Formula | C20H37N3 |
| Molecular Weight | 319.54 g/mol |
| Exact Mass | 319.30 |
| IUPAC Name | 5-[(Z)-octadec-9-enyl]-1H-1,2,4-triazole |
| SMILES | CCCCCCCC/C=C\CCCCCCCCc1ncn[nH]1 |
| InChI | InChI=1S/C20H37N3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-20-21-19-22-23-20/h9-10,19H,2-8,11-18H2,1H3,(H,21,22,23)/b10-9- |
| InChIKey | BETDTGMRGBXZCQ-KTKRTIGZSA-N |
| XLogP | 6.38 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.54 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|