C12H22N2O2S — CID 129434504
1-[(3R)-4-methylpent-1-yn-3-yl]-3-[(3R)-3-[(R)-methylsulfinyl]butyl]urea (PubChem CID 129434504) has the molecular formula C12H22N2O2S and a molecular weight of 258.39 g/mol. Its IUPAC name is 1-[(3R)-4-methylpent-1-yn-3-yl]-3-[(3R)-3-[(R)-methylsulfinyl]butyl]urea.
| Compound Name | 1-[(3R)-4-methylpent-1-yn-3-yl]-3-[(3R)-3-[(R)-methylsulfinyl]butyl]urea |
|---|---|
| PubChem CID | 129434504 |
| Molecular Formula | C12H22N2O2S |
| Molecular Weight | 258.39 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | 1-[(3R)-4-methylpent-1-yn-3-yl]-3-[(3R)-3-[(R)-methylsulfinyl]butyl]urea |
| SMILES | C#C[C@H](NC(=O)NCC[C@@H](C)[S@@](C)=O)C(C)C |
| InChI | InChI=1S/C12H22N2O2S/c1-6-11(9(2)3)14-12(15)13-8-7-10(4)17(5)16/h1,9-11H,7-8H2,2-5H3,(H2,13,14,15)/t10-,11+,17-/m1/s1 |
| InChIKey | ARSYHOYBHQGDHK-VGTOOOLASA-N |
| XLogP | 1.10 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.39 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|