C8H18N2O2S — CID 115729496
1,1-dimethyl-3-(3-methylsulfinylbutyl)urea (PubChem CID 115729496) has the molecular formula C8H18N2O2S and a molecular weight of 206.31 g/mol. Its IUPAC name is 1,1-dimethyl-3-(3-methylsulfinylbutyl)urea.
| Compound Name | 1,1-dimethyl-3-(3-methylsulfinylbutyl)urea |
|---|---|
| PubChem CID | 115729496 |
| Molecular Formula | C8H18N2O2S |
| Molecular Weight | 206.31 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 1,1-dimethyl-3-(3-methylsulfinylbutyl)urea |
| SMILES | CC(CCNC(=O)N(C)C)S(C)=O |
| InChI | InChI=1S/C8H18N2O2S/c1-7(13(4)12)5-6-9-8(11)10(2)3/h7H,5-6H2,1-4H3,(H,9,11) |
| InChIKey | PAZLYYMDBSWUIA-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.31 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |