C32H36ClN3O5 — CID 129436040
(1S,2R,5S,6S,7R)-6-N-(3-chlorophenyl)-2-N-[(1R,2S,3R)-2,3-dimethylcyclohexyl]-3-[(4-methoxyphenyl)methyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide (PubChem CID 129436040) has the molecular formula C32H36ClN3O5 and a molecular weight of 578.11 g/mol. Its IUPAC name is (1S,2R,5S,6S,7R)-6-N-(3-chlorophenyl)-2-N-[(1R,2S,3R)-2,3-dimethylcyclohexyl]-3-[(4-methoxyphenyl)methyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide.
| Compound Name | (1S,2R,5S,6S,7R)-6-N-(3-chlorophenyl)-2-N-[(1R,2S,3R)-2,3-dimethylcyclohexyl]-3-[(4-methoxyphenyl)methyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 129436040 |
| Molecular Formula | C32H36ClN3O5 |
| Molecular Weight | 578.11 g/mol |
| Exact Mass | 577.23 |
| IUPAC Name | (1S,2R,5S,6S,7R)-6-N-(3-chlorophenyl)-2-N-[(1R,2S,3R)-2,3-dimethylcyclohexyl]-3-[(4-methoxyphenyl)methyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
| SMILES | COc1ccc(CN2C(=O)[C@H]3[C@H](C(=O)Nc4cccc(Cl)c4)[C@H]4C=C[C@@]3(O4)[C@@H]2C(=O)N[C@@H]2CCC[C@@H](C)[C@@H]2C)cc1 |
| InChI | InChI=1S/C32H36ClN3O5/c1-18-6-4-9-24(19(18)2)35-30(38)28-32-15-14-25(41-32)26(29(37)34-22-8-5-7-21(33)16-22)27(32)31(39)36(28)17-20-10-12-23(40-3)13-11-20/h5,7-8,10-16,18-19,24-28H,4,6,9,17H2,1-3H3,(H,34,37)(H,35,38)/t18-,19+,24-,25-,26-,27-,28+,32+/m1/s1 |
| InChIKey | LGKZIFOZFISANP-KBOBPOKPSA-N |
| XLogP | 4.58 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.11 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|