C32H36ClN3O4 — CID 129435135
(1S,2R,5R,6S,7S)-6-N-(3-chlorophenyl)-2-N-[(1S,2S,3R)-2,3-dimethylcyclohexyl]-4-oxo-3-(2-phenylethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide (PubChem CID 129435135) has the molecular formula C32H36ClN3O4 and a molecular weight of 562.11 g/mol. Its IUPAC name is (1S,2R,5R,6S,7S)-6-N-(3-chlorophenyl)-2-N-[(1S,2S,3R)-2,3-dimethylcyclohexyl]-4-oxo-3-(2-phenylethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide.
| Compound Name | (1S,2R,5R,6S,7S)-6-N-(3-chlorophenyl)-2-N-[(1S,2S,3R)-2,3-dimethylcyclohexyl]-4-oxo-3-(2-phenylethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 129435135 |
| Molecular Formula | C32H36ClN3O4 |
| Molecular Weight | 562.11 g/mol |
| Exact Mass | 561.24 |
| IUPAC Name | (1S,2R,5R,6S,7S)-6-N-(3-chlorophenyl)-2-N-[(1S,2S,3R)-2,3-dimethylcyclohexyl]-4-oxo-3-(2-phenylethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
| SMILES | C[C@H]1[C@H](C)CCC[C@@H]1NC(=O)[C@@H]1N(CCc2ccccc2)C(=O)[C@@H]2[C@H](C(=O)Nc3cccc(Cl)c3)[C@@H]3C=C[C@]21O3 |
| InChI | InChI=1S/C32H36ClN3O4/c1-19-8-6-13-24(20(19)2)35-30(38)28-32-16-14-25(40-32)26(29(37)34-23-12-7-11-22(33)18-23)27(32)31(39)36(28)17-15-21-9-4-3-5-10-21/h3-5,7,9-12,14,16,18-20,24-28H,6,8,13,15,17H2,1-2H3,(H,34,37)(H,35,38)/t19-,20+,24+,25+,26-,27+,28+,32+/m1/s1 |
| InChIKey | BSMGAYIDCKMOTF-AKFYPKNYSA-N |
| XLogP | 4.61 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.11 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|