C30H41ClN4O4 — CID 87048755
(5R,7S)-6-N-(3-chlorophenyl)-3-[2-(diethylamino)ethyl]-2-N-(2,3-dimethylcyclohexyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide (PubChem CID 87048755) has the molecular formula C30H41ClN4O4 and a molecular weight of 557.14 g/mol. Its IUPAC name is (5R,7S)-6-N-(3-chlorophenyl)-3-[2-(diethylamino)ethyl]-2-N-(2,3-dimethylcyclohexyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide.
| Compound Name | (5R,7S)-6-N-(3-chlorophenyl)-3-[2-(diethylamino)ethyl]-2-N-(2,3-dimethylcyclohexyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 87048755 |
| Molecular Formula | C30H41ClN4O4 |
| Molecular Weight | 557.14 g/mol |
| Exact Mass | 556.28 |
| IUPAC Name | (5R,7S)-6-N-(3-chlorophenyl)-3-[2-(diethylamino)ethyl]-2-N-(2,3-dimethylcyclohexyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
| SMILES | CCN(CC)CCN1C(=O)[C@@H]2C(C(=O)Nc3cccc(Cl)c3)[C@@H]3C=CC2(O3)C1C(=O)NC1CCCC(C)C1C |
| InChI | InChI=1S/C30H41ClN4O4/c1-5-34(6-2)15-16-35-26(28(37)33-22-12-7-9-18(3)19(22)4)30-14-13-23(39-30)24(25(30)29(35)38)27(36)32-21-11-8-10-20(31)17-21/h8,10-11,13-14,17-19,22-26H,5-7,9,12,15-16H2,1-4H3,(H,32,36)(H,33,37)/t18?,19?,22?,23-,24?,25-,26?,30?/m0/s1 |
| InChIKey | SAIRYYOOICYACH-XYJOMCBRSA-N |
| XLogP | 3.71 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.14 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|