C31H43ClN4O4 — CID 129436606
(1S,2R,5R,6S,7S)-3-[2-[butyl(methyl)amino]ethyl]-6-N-(3-chlorophenyl)-2-N-[(1R,2R,3S)-2,3-dimethylcyclohexyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide (PubChem CID 129436606) has the molecular formula C31H43ClN4O4 and a molecular weight of 571.16 g/mol. Its IUPAC name is (1S,2R,5R,6S,7S)-3-[2-[butyl(methyl)amino]ethyl]-6-N-(3-chlorophenyl)-2-N-[(1R,2R,3S)-2,3-dimethylcyclohexyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide.
| Compound Name | (1S,2R,5R,6S,7S)-3-[2-[butyl(methyl)amino]ethyl]-6-N-(3-chlorophenyl)-2-N-[(1R,2R,3S)-2,3-dimethylcyclohexyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 129436606 |
| Molecular Formula | C31H43ClN4O4 |
| Molecular Weight | 571.16 g/mol |
| Exact Mass | 570.30 |
| IUPAC Name | (1S,2R,5R,6S,7S)-3-[2-[butyl(methyl)amino]ethyl]-6-N-(3-chlorophenyl)-2-N-[(1R,2R,3S)-2,3-dimethylcyclohexyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
| SMILES | CCCCN(C)CCN1C(=O)[C@@H]2[C@H](C(=O)Nc3cccc(Cl)c3)[C@@H]3C=C[C@@]2(O3)[C@@H]1C(=O)N[C@@H]1CCC[C@H](C)[C@H]1C |
| InChI | InChI=1S/C31H43ClN4O4/c1-5-6-15-35(4)16-17-36-27(29(38)34-23-12-7-9-19(2)20(23)3)31-14-13-24(40-31)25(26(31)30(36)39)28(37)33-22-11-8-10-21(32)18-22/h8,10-11,13-14,18-20,23-27H,5-7,9,12,15-17H2,1-4H3,(H,33,37)(H,34,38)/t19-,20+,23+,24-,25+,26-,27-,31-/m0/s1 |
| InChIKey | QQOSCEBXZGFPQD-JJBVTFBISA-N |
| XLogP | 4.10 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.16 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|