C28H35Cl2N3O4 — CID 129437492
(1S,2R,5S,6S,7R)-3-butyl-6-N-(3,5-dichlorophenyl)-2-N-[(1R,2R,3R)-2,3-dimethylcyclohexyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide (PubChem CID 129437492) has the molecular formula C28H35Cl2N3O4 and a molecular weight of 548.51 g/mol. Its IUPAC name is (1S,2R,5S,6S,7R)-3-butyl-6-N-(3,5-dichlorophenyl)-2-N-[(1R,2R,3R)-2,3-dimethylcyclohexyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide.
| Compound Name | (1S,2R,5S,6S,7R)-3-butyl-6-N-(3,5-dichlorophenyl)-2-N-[(1R,2R,3R)-2,3-dimethylcyclohexyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 129437492 |
| Molecular Formula | C28H35Cl2N3O4 |
| Molecular Weight | 548.51 g/mol |
| Exact Mass | 547.20 |
| IUPAC Name | (1S,2R,5S,6S,7R)-3-butyl-6-N-(3,5-dichlorophenyl)-2-N-[(1R,2R,3R)-2,3-dimethylcyclohexyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
| SMILES | CCCCN1C(=O)[C@H]2[C@H](C(=O)Nc3cc(Cl)cc(Cl)c3)[C@H]3C=C[C@@]2(O3)[C@@H]1C(=O)N[C@@H]1CCC[C@@H](C)[C@H]1C |
| InChI | InChI=1S/C28H35Cl2N3O4/c1-4-5-11-33-24(26(35)32-20-8-6-7-15(2)16(20)3)28-10-9-21(37-28)22(23(28)27(33)36)25(34)31-19-13-17(29)12-18(30)14-19/h9-10,12-16,20-24H,4-8,11H2,1-3H3,(H,31,34)(H,32,35)/t15-,16-,20-,21-,22-,23-,24+,28+/m1/s1 |
| InChIKey | ZVQJFOWNPKWXAY-SRUHHWTDSA-N |
| XLogP | 4.82 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.51 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|