C28H35Cl2N3O5 — CID 129435262
(1S,2R,5S,6S,7R)-6-N-(3,5-dichlorophenyl)-2-N-[(1R,2S,3R)-2,3-dimethylcyclohexyl]-3-(3-methoxypropyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide (PubChem CID 129435262) has the molecular formula C28H35Cl2N3O5 and a molecular weight of 564.51 g/mol. Its IUPAC name is (1S,2R,5S,6S,7R)-6-N-(3,5-dichlorophenyl)-2-N-[(1R,2S,3R)-2,3-dimethylcyclohexyl]-3-(3-methoxypropyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide.
| Compound Name | (1S,2R,5S,6S,7R)-6-N-(3,5-dichlorophenyl)-2-N-[(1R,2S,3R)-2,3-dimethylcyclohexyl]-3-(3-methoxypropyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 129435262 |
| Molecular Formula | C28H35Cl2N3O5 |
| Molecular Weight | 564.51 g/mol |
| Exact Mass | 563.20 |
| IUPAC Name | (1S,2R,5S,6S,7R)-6-N-(3,5-dichlorophenyl)-2-N-[(1R,2S,3R)-2,3-dimethylcyclohexyl]-3-(3-methoxypropyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
| SMILES | COCCCN1C(=O)[C@H]2[C@H](C(=O)Nc3cc(Cl)cc(Cl)c3)[C@H]3C=C[C@@]2(O3)[C@@H]1C(=O)N[C@@H]1CCC[C@@H](C)[C@@H]1C |
| InChI | InChI=1S/C28H35Cl2N3O5/c1-15-6-4-7-20(16(15)2)32-26(35)24-28-9-8-21(38-28)22(23(28)27(36)33(24)10-5-11-37-3)25(34)31-19-13-17(29)12-18(30)14-19/h8-9,12-16,20-24H,4-7,10-11H2,1-3H3,(H,31,34)(H,32,35)/t15-,16+,20-,21-,22-,23-,24+,28+/m1/s1 |
| InChIKey | CWGZYOGHCNVEKX-ZAEKLRKKSA-N |
| XLogP | 4.06 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.51 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|