C30H40Cl2N4O4 — CID 129435606
(1S,2R,5R,6S,7S)-6-N-(3,5-dichlorophenyl)-3-[2-(diethylamino)ethyl]-2-N-[(1R,2R,3R)-2,3-dimethylcyclohexyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide (PubChem CID 129435606) has the molecular formula C30H40Cl2N4O4 and a molecular weight of 591.58 g/mol. Its IUPAC name is (1S,2R,5R,6S,7S)-6-N-(3,5-dichlorophenyl)-3-[2-(diethylamino)ethyl]-2-N-[(1R,2R,3R)-2,3-dimethylcyclohexyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide.
| Compound Name | (1S,2R,5R,6S,7S)-6-N-(3,5-dichlorophenyl)-3-[2-(diethylamino)ethyl]-2-N-[(1R,2R,3R)-2,3-dimethylcyclohexyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 129435606 |
| Molecular Formula | C30H40Cl2N4O4 |
| Molecular Weight | 591.58 g/mol |
| Exact Mass | 590.24 |
| IUPAC Name | (1S,2R,5R,6S,7S)-6-N-(3,5-dichlorophenyl)-3-[2-(diethylamino)ethyl]-2-N-[(1R,2R,3R)-2,3-dimethylcyclohexyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
| SMILES | CCN(CC)CCN1C(=O)[C@@H]2[C@H](C(=O)Nc3cc(Cl)cc(Cl)c3)[C@@H]3C=C[C@@]2(O3)[C@@H]1C(=O)N[C@@H]1CCC[C@@H](C)[C@H]1C |
| InChI | InChI=1S/C30H40Cl2N4O4/c1-5-35(6-2)12-13-36-26(28(38)34-22-9-7-8-17(3)18(22)4)30-11-10-23(40-30)24(25(30)29(36)39)27(37)33-21-15-19(31)14-20(32)16-21/h10-11,14-18,22-26H,5-9,12-13H2,1-4H3,(H,33,37)(H,34,38)/t17-,18-,22-,23+,24-,25+,26+,30+/m1/s1 |
| InChIKey | HJBBOEJYHKWFKY-SIJLOEIBSA-N |
| XLogP | 4.37 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.58 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|