C32H46Cl2N4O4 — CID 146051519
(5R,7S)-6-N-(3-chlorophenyl)-2-N-(2,3-dimethylcyclohexyl)-3-[2-(dipropylamino)ethyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide;hydrochloride (PubChem CID 146051519) has the molecular formula C32H46Cl2N4O4 and a molecular weight of 621.65 g/mol. Its IUPAC name is (5R,7S)-6-N-(3-chlorophenyl)-2-N-(2,3-dimethylcyclohexyl)-3-[2-(dipropylamino)ethyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide;hydrochloride.
| Compound Name | (5R,7S)-6-N-(3-chlorophenyl)-2-N-(2,3-dimethylcyclohexyl)-3-[2-(dipropylamino)ethyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide;hydrochloride |
|---|---|
| PubChem CID | 146051519 |
| Molecular Formula | C32H46Cl2N4O4 |
| Molecular Weight | 621.65 g/mol |
| Exact Mass | 620.29 |
| IUPAC Name | (5R,7S)-6-N-(3-chlorophenyl)-2-N-(2,3-dimethylcyclohexyl)-3-[2-(dipropylamino)ethyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide;hydrochloride |
| SMILES | CCCN(CCC)CCN1C(=O)[C@@H]2C(C(=O)Nc3cccc(Cl)c3)[C@@H]3C=CC2(O3)C1C(=O)NC1CCCC(C)C1C.Cl |
| InChI | InChI=1S/C32H45ClN4O4.ClH/c1-5-15-36(16-6-2)17-18-37-28(30(39)35-24-12-7-9-20(3)21(24)4)32-14-13-25(41-32)26(27(32)31(37)40)29(38)34-23-11-8-10-22(33)19-23;/h8,10-11,13-14,19-21,24-28H,5-7,9,12,15-18H2,1-4H3,(H,34,38)(H,35,39);1H/t20?,21?,24?,25-,26?,27-,28?,32?;/m0./s1 |
| InChIKey | BKOCJPOZHSZORK-FONVRCOSSA-N |
| XLogP | 4.91 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.65 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|