C32H44Cl2N4O4 — CID 99756435
(1S,2R,5R,6S,7S)-6-N-(3,5-dichlorophenyl)-2-N-[(1R,2S,3R)-2,3-dimethylcyclohexyl]-3-[2-(dipropylamino)ethyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide (PubChem CID 99756435) has the molecular formula C32H44Cl2N4O4 and a molecular weight of 619.63 g/mol. Its IUPAC name is (1S,2R,5R,6S,7S)-6-N-(3,5-dichlorophenyl)-2-N-[(1R,2S,3R)-2,3-dimethylcyclohexyl]-3-[2-(dipropylamino)ethyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide.
| Compound Name | (1S,2R,5R,6S,7S)-6-N-(3,5-dichlorophenyl)-2-N-[(1R,2S,3R)-2,3-dimethylcyclohexyl]-3-[2-(dipropylamino)ethyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 99756435 |
| Molecular Formula | C32H44Cl2N4O4 |
| Molecular Weight | 619.63 g/mol |
| Exact Mass | 618.27 |
| IUPAC Name | (1S,2R,5R,6S,7S)-6-N-(3,5-dichlorophenyl)-2-N-[(1R,2S,3R)-2,3-dimethylcyclohexyl]-3-[2-(dipropylamino)ethyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
| SMILES | CCCN(CCC)CCN1C(=O)[C@@H]2[C@H](C(=O)Nc3cc(Cl)cc(Cl)c3)[C@@H]3C=C[C@@]2(O3)[C@@H]1C(=O)N[C@@H]1CCC[C@@H](C)[C@@H]1C |
| InChI | InChI=1S/C32H44Cl2N4O4/c1-5-12-37(13-6-2)14-15-38-28(30(40)36-24-9-7-8-19(3)20(24)4)32-11-10-25(42-32)26(27(32)31(38)41)29(39)35-23-17-21(33)16-22(34)18-23/h10-11,16-20,24-28H,5-9,12-15H2,1-4H3,(H,35,39)(H,36,40)/t19-,20+,24-,25+,26-,27+,28+,32+/m1/s1 |
| InChIKey | UOFPZFWUNXOMDD-VMBFSZNWSA-N |
| XLogP | 5.15 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.63 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|