C27H33Cl2N3O5 — CID 129435317
(1S,2R,5S,6S,7R)-6-N-(3,5-dichlorophenyl)-2-N-[(1R,2R,3S)-2,3-dimethylcyclohexyl]-3-(2-methoxyethyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide (PubChem CID 129435317) has the molecular formula C27H33Cl2N3O5 and a molecular weight of 550.48 g/mol. Its IUPAC name is (1S,2R,5S,6S,7R)-6-N-(3,5-dichlorophenyl)-2-N-[(1R,2R,3S)-2,3-dimethylcyclohexyl]-3-(2-methoxyethyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide.
| Compound Name | (1S,2R,5S,6S,7R)-6-N-(3,5-dichlorophenyl)-2-N-[(1R,2R,3S)-2,3-dimethylcyclohexyl]-3-(2-methoxyethyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 129435317 |
| Molecular Formula | C27H33Cl2N3O5 |
| Molecular Weight | 550.48 g/mol |
| Exact Mass | 549.18 |
| IUPAC Name | (1S,2R,5S,6S,7R)-6-N-(3,5-dichlorophenyl)-2-N-[(1R,2R,3S)-2,3-dimethylcyclohexyl]-3-(2-methoxyethyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
| SMILES | COCCN1C(=O)[C@H]2[C@H](C(=O)Nc3cc(Cl)cc(Cl)c3)[C@H]3C=C[C@@]2(O3)[C@@H]1C(=O)N[C@@H]1CCC[C@H](C)[C@H]1C |
| InChI | InChI=1S/C27H33Cl2N3O5/c1-14-5-4-6-19(15(14)2)31-25(34)23-27-8-7-20(37-27)21(22(27)26(35)32(23)9-10-36-3)24(33)30-18-12-16(28)11-17(29)13-18/h7-8,11-15,19-23H,4-6,9-10H2,1-3H3,(H,30,33)(H,31,34)/t14-,15+,19+,20+,21+,22+,23-,27-/m0/s1 |
| InChIKey | DNXNJLUFORXRIU-YAFZYVQKSA-N |
| XLogP | 3.67 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.48 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|