C34H41N3O4 — CID 46503797
2-N-(2,3-dimethylcyclohexyl)-6-N-(3,5-dimethylphenyl)-4-oxo-3-(2-phenylethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide (PubChem CID 46503797) has the molecular formula C34H41N3O4 and a molecular weight of 555.72 g/mol. Its IUPAC name is 2-N-(2,3-dimethylcyclohexyl)-6-N-(3,5-dimethylphenyl)-4-oxo-3-(2-phenylethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide.
| Compound Name | 2-N-(2,3-dimethylcyclohexyl)-6-N-(3,5-dimethylphenyl)-4-oxo-3-(2-phenylethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 46503797 |
| Molecular Formula | C34H41N3O4 |
| Molecular Weight | 555.72 g/mol |
| Exact Mass | 555.31 |
| IUPAC Name | 2-N-(2,3-dimethylcyclohexyl)-6-N-(3,5-dimethylphenyl)-4-oxo-3-(2-phenylethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
| SMILES | Cc1cc(C)cc(NC(=O)C2C3C=CC4(O3)C2C(=O)N(CCc2ccccc2)C4C(=O)NC2CCCC(C)C2C)c1 |
| InChI | InChI=1S/C34H41N3O4/c1-20-17-21(2)19-25(18-20)35-31(38)28-27-13-15-34(41-27)29(28)33(40)37(16-14-24-10-6-5-7-11-24)30(34)32(39)36-26-12-8-9-22(3)23(26)4/h5-7,10-11,13,15,17-19,22-23,26-30H,8-9,12,14,16H2,1-4H3,(H,35,38)(H,36,39) |
| InChIKey | TTXUUHZIRWYIDH-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.72 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|