C33H39N3O5 — CID 87048718
(5R,7S)-2-N-(2,3-dimethylcyclohexyl)-6-N-(4-methoxyphenyl)-4-oxo-3-(2-phenylethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide (PubChem CID 87048718) has the molecular formula C33H39N3O5 and a molecular weight of 557.69 g/mol. Its IUPAC name is (5R,7S)-2-N-(2,3-dimethylcyclohexyl)-6-N-(4-methoxyphenyl)-4-oxo-3-(2-phenylethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide.
| Compound Name | (5R,7S)-2-N-(2,3-dimethylcyclohexyl)-6-N-(4-methoxyphenyl)-4-oxo-3-(2-phenylethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 87048718 |
| Molecular Formula | C33H39N3O5 |
| Molecular Weight | 557.69 g/mol |
| Exact Mass | 557.29 |
| IUPAC Name | (5R,7S)-2-N-(2,3-dimethylcyclohexyl)-6-N-(4-methoxyphenyl)-4-oxo-3-(2-phenylethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
| SMILES | COc1ccc(NC(=O)C2[C@@H]3C=CC4(O3)C(C(=O)NC3CCCC(C)C3C)N(CCc3ccccc3)C(=O)[C@H]24)cc1 |
| InChI | InChI=1S/C33H39N3O5/c1-20-8-7-11-25(21(20)2)35-31(38)29-33-18-16-26(41-33)27(30(37)34-23-12-14-24(40-3)15-13-23)28(33)32(39)36(29)19-17-22-9-5-4-6-10-22/h4-6,9-10,12-16,18,20-21,25-29H,7-8,11,17,19H2,1-3H3,(H,34,37)(H,35,38)/t20?,21?,25?,26-,27?,28-,29?,33?/m0/s1 |
| InChIKey | RXWHTQNYFYARGA-IAXLOIHYSA-N |
| XLogP | 3.97 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.69 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|