C34H41N3O5 — CID 129436331
(1S,2R,5S,6S,7R)-2-N-[(1R,2S,3R)-2,3-dimethylcyclohexyl]-6-N-(3,5-dimethylphenyl)-3-[(3-methoxyphenyl)methyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide (PubChem CID 129436331) has the molecular formula C34H41N3O5 and a molecular weight of 571.72 g/mol. Its IUPAC name is (1S,2R,5S,6S,7R)-2-N-[(1R,2S,3R)-2,3-dimethylcyclohexyl]-6-N-(3,5-dimethylphenyl)-3-[(3-methoxyphenyl)methyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide.
| Compound Name | (1S,2R,5S,6S,7R)-2-N-[(1R,2S,3R)-2,3-dimethylcyclohexyl]-6-N-(3,5-dimethylphenyl)-3-[(3-methoxyphenyl)methyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 129436331 |
| Molecular Formula | C34H41N3O5 |
| Molecular Weight | 571.72 g/mol |
| Exact Mass | 571.30 |
| IUPAC Name | (1S,2R,5S,6S,7R)-2-N-[(1R,2S,3R)-2,3-dimethylcyclohexyl]-6-N-(3,5-dimethylphenyl)-3-[(3-methoxyphenyl)methyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
| SMILES | COc1cccc(CN2C(=O)[C@H]3[C@H](C(=O)Nc4cc(C)cc(C)c4)[C@H]4C=C[C@@]3(O4)[C@@H]2C(=O)N[C@@H]2CCC[C@@H](C)[C@@H]2C)c1 |
| InChI | InChI=1S/C34H41N3O5/c1-19-14-20(2)16-24(15-19)35-31(38)28-27-12-13-34(42-27)29(28)33(40)37(18-23-9-7-10-25(17-23)41-5)30(34)32(39)36-26-11-6-8-21(3)22(26)4/h7,9-10,12-17,21-22,26-30H,6,8,11,18H2,1-5H3,(H,35,38)(H,36,39)/t21-,22+,26-,27-,28-,29-,30+,34+/m1/s1 |
| InChIKey | NYEPARIZOOXZLF-SHSVEOAISA-N |
| XLogP | 4.54 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.72 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|