C33H39N3O6 — CID 129436597
(1S,2R,5R,6S,7S)-6-N-(4-ethoxyphenyl)-3-[(3-methoxyphenyl)methyl]-2-N-[(1R,2R)-2-methylcyclohexyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide (PubChem CID 129436597) has the molecular formula C33H39N3O6 and a molecular weight of 573.69 g/mol. Its IUPAC name is (1S,2R,5R,6S,7S)-6-N-(4-ethoxyphenyl)-3-[(3-methoxyphenyl)methyl]-2-N-[(1R,2R)-2-methylcyclohexyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide.
| Compound Name | (1S,2R,5R,6S,7S)-6-N-(4-ethoxyphenyl)-3-[(3-methoxyphenyl)methyl]-2-N-[(1R,2R)-2-methylcyclohexyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 129436597 |
| Molecular Formula | C33H39N3O6 |
| Molecular Weight | 573.69 g/mol |
| Exact Mass | 573.28 |
| IUPAC Name | (1S,2R,5R,6S,7S)-6-N-(4-ethoxyphenyl)-3-[(3-methoxyphenyl)methyl]-2-N-[(1R,2R)-2-methylcyclohexyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
| SMILES | CCOc1ccc(NC(=O)[C@@H]2[C@@H]3C=C[C@]4(O3)[C@@H]2C(=O)N(Cc2cccc(OC)c2)[C@H]4C(=O)N[C@@H]2CCCC[C@H]2C)cc1 |
| InChI | InChI=1S/C33H39N3O6/c1-4-41-23-14-12-22(13-15-23)34-30(37)27-26-16-17-33(42-26)28(27)32(39)36(19-21-9-7-10-24(18-21)40-3)29(33)31(38)35-25-11-6-5-8-20(25)2/h7,9-10,12-18,20,25-29H,4-6,8,11,19H2,1-3H3,(H,34,37)(H,35,38)/t20-,25-,26+,27-,28+,29+,33+/m1/s1 |
| InChIKey | QQFXAWXSYISJOX-KFVFBTNASA-N |
| XLogP | 4.08 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.69 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|