C31H36N4O4 — CID 129435842
(1R,2S,5S,6R,7R)-2-N-[(1R,2R,3S)-2,3-dimethylcyclohexyl]-6-N-(3-methylphenyl)-4-oxo-3-(pyridin-3-ylmethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide (PubChem CID 129435842) has the molecular formula C31H36N4O4 and a molecular weight of 528.65 g/mol. Its IUPAC name is (1R,2S,5S,6R,7R)-2-N-[(1R,2R,3S)-2,3-dimethylcyclohexyl]-6-N-(3-methylphenyl)-4-oxo-3-(pyridin-3-ylmethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide.
| Compound Name | (1R,2S,5S,6R,7R)-2-N-[(1R,2R,3S)-2,3-dimethylcyclohexyl]-6-N-(3-methylphenyl)-4-oxo-3-(pyridin-3-ylmethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 129435842 |
| Molecular Formula | C31H36N4O4 |
| Molecular Weight | 528.65 g/mol |
| Exact Mass | 528.27 |
| IUPAC Name | (1R,2S,5S,6R,7R)-2-N-[(1R,2R,3S)-2,3-dimethylcyclohexyl]-6-N-(3-methylphenyl)-4-oxo-3-(pyridin-3-ylmethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
| SMILES | Cc1cccc(NC(=O)[C@H]2[C@H]3C=C[C@@]4(O3)[C@H]2C(=O)N(Cc2cccnc2)[C@@H]4C(=O)N[C@@H]2CCC[C@H](C)[C@H]2C)c1 |
| InChI | InChI=1S/C31H36N4O4/c1-18-7-4-10-22(15-18)33-28(36)25-24-12-13-31(39-24)26(25)30(38)35(17-21-9-6-14-32-16-21)27(31)29(37)34-23-11-5-8-19(2)20(23)3/h4,6-7,9-10,12-16,19-20,23-27H,5,8,11,17H2,1-3H3,(H,33,36)(H,34,37)/t19-,20+,23+,24+,25-,26+,27+,31+/m0/s1 |
| InChIKey | JILVMBGRBMXQTP-FRGLJFDKSA-N |
| XLogP | 3.62 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.65 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|