C32H38N4O4 — CID 129435782
(1R,2S,5S,6R,7R)-2-N-[(1R,2R,3R)-2,3-dimethylcyclohexyl]-6-N-(3,4-dimethylphenyl)-4-oxo-3-(pyridin-3-ylmethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide (PubChem CID 129435782) has the molecular formula C32H38N4O4 and a molecular weight of 542.68 g/mol. Its IUPAC name is (1R,2S,5S,6R,7R)-2-N-[(1R,2R,3R)-2,3-dimethylcyclohexyl]-6-N-(3,4-dimethylphenyl)-4-oxo-3-(pyridin-3-ylmethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide.
| Compound Name | (1R,2S,5S,6R,7R)-2-N-[(1R,2R,3R)-2,3-dimethylcyclohexyl]-6-N-(3,4-dimethylphenyl)-4-oxo-3-(pyridin-3-ylmethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 129435782 |
| Molecular Formula | C32H38N4O4 |
| Molecular Weight | 542.68 g/mol |
| Exact Mass | 542.29 |
| IUPAC Name | (1R,2S,5S,6R,7R)-2-N-[(1R,2R,3R)-2,3-dimethylcyclohexyl]-6-N-(3,4-dimethylphenyl)-4-oxo-3-(pyridin-3-ylmethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
| SMILES | Cc1ccc(NC(=O)[C@H]2[C@H]3C=C[C@@]4(O3)[C@H]2C(=O)N(Cc2cccnc2)[C@@H]4C(=O)N[C@@H]2CCC[C@@H](C)[C@H]2C)cc1C |
| InChI | InChI=1S/C32H38N4O4/c1-18-10-11-23(15-20(18)3)34-29(37)26-25-12-13-32(40-25)27(26)31(39)36(17-22-8-6-14-33-16-22)28(32)30(38)35-24-9-5-7-19(2)21(24)4/h6,8,10-16,19,21,24-28H,5,7,9,17H2,1-4H3,(H,34,37)(H,35,38)/t19-,21-,24-,25-,26+,27-,28-,32-/m1/s1 |
| InChIKey | IUDCGBRHYDWDEK-JMVHPFEZSA-N |
| XLogP | 3.93 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.68 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|