C34H48N4O4 — CID 129436347
(1S,2R,5R,6S,7S)-3-[2-(azepan-1-yl)ethyl]-2-N-[(1R,2R,3S)-2,3-dimethylcyclohexyl]-6-N-(3,4-dimethylphenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide (PubChem CID 129436347) has the molecular formula C34H48N4O4 and a molecular weight of 576.78 g/mol. Its IUPAC name is (1S,2R,5R,6S,7S)-3-[2-(azepan-1-yl)ethyl]-2-N-[(1R,2R,3S)-2,3-dimethylcyclohexyl]-6-N-(3,4-dimethylphenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide.
| Compound Name | (1S,2R,5R,6S,7S)-3-[2-(azepan-1-yl)ethyl]-2-N-[(1R,2R,3S)-2,3-dimethylcyclohexyl]-6-N-(3,4-dimethylphenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 129436347 |
| Molecular Formula | C34H48N4O4 |
| Molecular Weight | 576.78 g/mol |
| Exact Mass | 576.37 |
| IUPAC Name | (1S,2R,5R,6S,7S)-3-[2-(azepan-1-yl)ethyl]-2-N-[(1R,2R,3S)-2,3-dimethylcyclohexyl]-6-N-(3,4-dimethylphenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
| SMILES | Cc1ccc(NC(=O)[C@@H]2[C@@H]3C=C[C@]4(O3)[C@@H]2C(=O)N(CCN2CCCCCC2)[C@H]4C(=O)N[C@@H]2CCC[C@H](C)[C@H]2C)cc1C |
| InChI | InChI=1S/C34H48N4O4/c1-21-12-13-25(20-23(21)3)35-31(39)28-27-14-15-34(42-27)29(28)33(41)38(19-18-37-16-7-5-6-8-17-37)30(34)32(40)36-26-11-9-10-22(2)24(26)4/h12-15,20,22,24,26-30H,5-11,16-19H2,1-4H3,(H,35,39)(H,36,40)/t22-,24+,26+,27-,28+,29-,30-,34-/m0/s1 |
| InChIKey | OBUKSEKJBYMKAX-UHJPUYRMSA-N |
| XLogP | 4.21 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.78 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|