C32H44N4O4 — CID 87049105
(5S,7R)-2-N-(2,3-dimethylcyclohexyl)-6-N-(3-methylphenyl)-4-oxo-3-(3-pyrrolidin-1-ylpropyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide (PubChem CID 87049105) has the molecular formula C32H44N4O4 and a molecular weight of 548.73 g/mol. Its IUPAC name is (5S,7R)-2-N-(2,3-dimethylcyclohexyl)-6-N-(3-methylphenyl)-4-oxo-3-(3-pyrrolidin-1-ylpropyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide.
| Compound Name | (5S,7R)-2-N-(2,3-dimethylcyclohexyl)-6-N-(3-methylphenyl)-4-oxo-3-(3-pyrrolidin-1-ylpropyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 87049105 |
| Molecular Formula | C32H44N4O4 |
| Molecular Weight | 548.73 g/mol |
| Exact Mass | 548.34 |
| IUPAC Name | (5S,7R)-2-N-(2,3-dimethylcyclohexyl)-6-N-(3-methylphenyl)-4-oxo-3-(3-pyrrolidin-1-ylpropyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
| SMILES | Cc1cccc(NC(=O)C2[C@H]3C=CC4(O3)C(C(=O)NC3CCCC(C)C3C)N(CCCN3CCCC3)C(=O)[C@@H]24)c1 |
| InChI | InChI=1S/C32H44N4O4/c1-20-9-6-11-23(19-20)33-29(37)26-25-13-14-32(40-25)27(26)31(39)36(18-8-17-35-15-4-5-16-35)28(32)30(38)34-24-12-7-10-21(2)22(24)3/h6,9,11,13-14,19,21-22,24-28H,4-5,7-8,10,12,15-18H2,1-3H3,(H,33,37)(H,34,38)/t21?,22?,24?,25-,26?,27-,28?,32?/m1/s1 |
| InChIKey | VTFAPNOQYZVXIG-YYJKDBOPSA-N |
| XLogP | 3.51 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.73 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|