C31H41ClN4O5 — CID 99756125
(1S,2R,5R,6R,7S)-6-N-(3-chlorophenyl)-2-N-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-3-(3-morpholin-4-ylpropyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide (PubChem CID 99756125) has the molecular formula C31H41ClN4O5 and a molecular weight of 585.15 g/mol. Its IUPAC name is (1S,2R,5R,6R,7S)-6-N-(3-chlorophenyl)-2-N-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-3-(3-morpholin-4-ylpropyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide.
| Compound Name | (1S,2R,5R,6R,7S)-6-N-(3-chlorophenyl)-2-N-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-3-(3-morpholin-4-ylpropyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 99756125 |
| Molecular Formula | C31H41ClN4O5 |
| Molecular Weight | 585.15 g/mol |
| Exact Mass | 584.28 |
| IUPAC Name | (1S,2R,5R,6R,7S)-6-N-(3-chlorophenyl)-2-N-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-3-(3-morpholin-4-ylpropyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
| SMILES | C[C@@H]1[C@H](C)CCC[C@@H]1NC(=O)[C@@H]1N(CCCN2CCOCC2)C(=O)[C@@H]2[C@@H](C(=O)Nc3cccc(Cl)c3)[C@@H]3C=C[C@]21O3 |
| InChI | InChI=1S/C31H41ClN4O5/c1-19-6-3-9-23(20(19)2)34-29(38)27-31-11-10-24(41-31)25(28(37)33-22-8-4-7-21(32)18-22)26(31)30(39)36(27)13-5-12-35-14-16-40-17-15-35/h4,7-8,10-11,18-20,23-27H,3,5-6,9,12-17H2,1-2H3,(H,33,37)(H,34,38)/t19-,20-,23+,24+,25+,26+,27+,31+/m1/s1 |
| InChIKey | OATLFHJHPFBXMN-QYLUTMGFSA-N |
| XLogP | 3.09 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.15 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|