C34H48N4O5 — CID 87048988
(5R,7S)-2-N-(2,3-dimethylcyclohexyl)-3-(3-morpholin-4-ylpropyl)-4-oxo-6-N-(4-propan-2-ylphenyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide (PubChem CID 87048988) has the molecular formula C34H48N4O5 and a molecular weight of 592.78 g/mol. Its IUPAC name is (5R,7S)-2-N-(2,3-dimethylcyclohexyl)-3-(3-morpholin-4-ylpropyl)-4-oxo-6-N-(4-propan-2-ylphenyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide.
| Compound Name | (5R,7S)-2-N-(2,3-dimethylcyclohexyl)-3-(3-morpholin-4-ylpropyl)-4-oxo-6-N-(4-propan-2-ylphenyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 87048988 |
| Molecular Formula | C34H48N4O5 |
| Molecular Weight | 592.78 g/mol |
| Exact Mass | 592.36 |
| IUPAC Name | (5R,7S)-2-N-(2,3-dimethylcyclohexyl)-3-(3-morpholin-4-ylpropyl)-4-oxo-6-N-(4-propan-2-ylphenyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
| SMILES | CC(C)c1ccc(NC(=O)C2[C@@H]3C=CC4(O3)C(C(=O)NC3CCCC(C)C3C)N(CCCN3CCOCC3)C(=O)[C@H]24)cc1 |
| InChI | InChI=1S/C34H48N4O5/c1-21(2)24-9-11-25(12-10-24)35-31(39)28-27-13-14-34(43-27)29(28)33(41)38(16-6-15-37-17-19-42-20-18-37)30(34)32(40)36-26-8-5-7-22(3)23(26)4/h9-14,21-23,26-30H,5-8,15-20H2,1-4H3,(H,35,39)(H,36,40)/t22?,23?,26?,27-,28?,29-,30?,34?/m0/s1 |
| InChIKey | UOIUETMCPDDRJY-MGTLCFISSA-N |
| XLogP | 3.56 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.78 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|