C31H43ClN4O6 — CID 146051516
(5R,7S)-2-N-(2,3-dimethylcyclohexyl)-6-N-(4-methoxyphenyl)-3-(2-morpholin-4-ylethyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide;hydrochloride (PubChem CID 146051516) has the molecular formula C31H43ClN4O6 and a molecular weight of 603.16 g/mol. Its IUPAC name is (5R,7S)-2-N-(2,3-dimethylcyclohexyl)-6-N-(4-methoxyphenyl)-3-(2-morpholin-4-ylethyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide;hydrochloride.
| Compound Name | (5R,7S)-2-N-(2,3-dimethylcyclohexyl)-6-N-(4-methoxyphenyl)-3-(2-morpholin-4-ylethyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide;hydrochloride |
|---|---|
| PubChem CID | 146051516 |
| Molecular Formula | C31H43ClN4O6 |
| Molecular Weight | 603.16 g/mol |
| Exact Mass | 602.29 |
| IUPAC Name | (5R,7S)-2-N-(2,3-dimethylcyclohexyl)-6-N-(4-methoxyphenyl)-3-(2-morpholin-4-ylethyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide;hydrochloride |
| SMILES | COc1ccc(NC(=O)C2[C@@H]3C=CC4(O3)C(C(=O)NC3CCCC(C)C3C)N(CCN3CCOCC3)C(=O)[C@H]24)cc1.Cl |
| InChI | InChI=1S/C31H42N4O6.ClH/c1-19-5-4-6-23(20(19)2)33-29(37)27-31-12-11-24(41-31)25(28(36)32-21-7-9-22(39-3)10-8-21)26(31)30(38)35(27)14-13-34-15-17-40-18-16-34;/h7-12,19-20,23-27H,4-6,13-18H2,1-3H3,(H,32,36)(H,33,37);1H/t19?,20?,23?,24-,25?,26-,27?,31?;/m0./s1 |
| InChIKey | GPMPXBAZKPOVAD-JKERWDSRSA-N |
| XLogP | 2.48 |
| TPSA | 109.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.16 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|