C33H46N4O5 — CID 99751095
(1R,2S,5S,6R,7R)-2-N-[(1R,2S,3R)-2,3-dimethylcyclohexyl]-3-(2-morpholin-4-ylethyl)-4-oxo-6-N-(4-propan-2-ylphenyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide (PubChem CID 99751095) has the molecular formula C33H46N4O5 and a molecular weight of 578.75 g/mol. Its IUPAC name is (1R,2S,5S,6R,7R)-2-N-[(1R,2S,3R)-2,3-dimethylcyclohexyl]-3-(2-morpholin-4-ylethyl)-4-oxo-6-N-(4-propan-2-ylphenyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide.
| Compound Name | (1R,2S,5S,6R,7R)-2-N-[(1R,2S,3R)-2,3-dimethylcyclohexyl]-3-(2-morpholin-4-ylethyl)-4-oxo-6-N-(4-propan-2-ylphenyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 99751095 |
| Molecular Formula | C33H46N4O5 |
| Molecular Weight | 578.75 g/mol |
| Exact Mass | 578.35 |
| IUPAC Name | (1R,2S,5S,6R,7R)-2-N-[(1R,2S,3R)-2,3-dimethylcyclohexyl]-3-(2-morpholin-4-ylethyl)-4-oxo-6-N-(4-propan-2-ylphenyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
| SMILES | CC(C)c1ccc(NC(=O)[C@H]2[C@H]3C=C[C@@]4(O3)[C@H]2C(=O)N(CCN2CCOCC2)[C@@H]4C(=O)N[C@@H]2CCC[C@@H](C)[C@@H]2C)cc1 |
| InChI | InChI=1S/C33H46N4O5/c1-20(2)23-8-10-24(11-9-23)34-30(38)27-26-12-13-33(42-26)28(27)32(40)37(15-14-36-16-18-41-19-17-36)29(33)31(39)35-25-7-5-6-21(3)22(25)4/h8-13,20-22,25-29H,5-7,14-19H2,1-4H3,(H,34,38)(H,35,39)/t21-,22+,25-,26-,27+,28-,29-,33-/m1/s1 |
| InChIKey | VRZIPOIGNOCLAG-QUZBXVJESA-N |
| XLogP | 3.17 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.75 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|