C34H41N3O4 — CID 129436340
(1R,2S,5S,6R,7R)-3-benzyl-2-N-[(1R,2S,3S)-2,3-dimethylcyclohexyl]-4-oxo-6-N-(4-propan-2-ylphenyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide (PubChem CID 129436340) has the molecular formula C34H41N3O4 and a molecular weight of 555.72 g/mol. Its IUPAC name is (1R,2S,5S,6R,7R)-3-benzyl-2-N-[(1R,2S,3S)-2,3-dimethylcyclohexyl]-4-oxo-6-N-(4-propan-2-ylphenyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide.
| Compound Name | (1R,2S,5S,6R,7R)-3-benzyl-2-N-[(1R,2S,3S)-2,3-dimethylcyclohexyl]-4-oxo-6-N-(4-propan-2-ylphenyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 129436340 |
| Molecular Formula | C34H41N3O4 |
| Molecular Weight | 555.72 g/mol |
| Exact Mass | 555.31 |
| IUPAC Name | (1R,2S,5S,6R,7R)-3-benzyl-2-N-[(1R,2S,3S)-2,3-dimethylcyclohexyl]-4-oxo-6-N-(4-propan-2-ylphenyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
| SMILES | CC(C)c1ccc(NC(=O)[C@H]2[C@H]3C=C[C@@]4(O3)[C@H]2C(=O)N(Cc2ccccc2)[C@@H]4C(=O)N[C@@H]2CCC[C@H](C)[C@@H]2C)cc1 |
| InChI | InChI=1S/C34H41N3O4/c1-20(2)24-13-15-25(16-14-24)35-31(38)28-27-17-18-34(41-27)29(28)33(40)37(19-23-10-6-5-7-11-23)30(34)32(39)36-26-12-8-9-21(3)22(26)4/h5-7,10-11,13-18,20-22,26-30H,8-9,12,19H2,1-4H3,(H,35,38)(H,36,39)/t21-,22-,26+,27+,28-,29+,30+,34+/m0/s1 |
| InChIKey | OACKPGIXIIFSPV-VLNRYPBQSA-N |
| XLogP | 5.04 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.72 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|