C35H50N4O4 — CID 99751113
(1R,2S,5S,6R,7R)-3-[2-(azepan-1-yl)ethyl]-2-N-[(1R,2S,3R)-2,3-dimethylcyclohexyl]-4-oxo-6-N-(4-propan-2-ylphenyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide (PubChem CID 99751113) has the molecular formula C35H50N4O4 and a molecular weight of 590.81 g/mol. Its IUPAC name is (1R,2S,5S,6R,7R)-3-[2-(azepan-1-yl)ethyl]-2-N-[(1R,2S,3R)-2,3-dimethylcyclohexyl]-4-oxo-6-N-(4-propan-2-ylphenyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide.
| Compound Name | (1R,2S,5S,6R,7R)-3-[2-(azepan-1-yl)ethyl]-2-N-[(1R,2S,3R)-2,3-dimethylcyclohexyl]-4-oxo-6-N-(4-propan-2-ylphenyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 99751113 |
| Molecular Formula | C35H50N4O4 |
| Molecular Weight | 590.81 g/mol |
| Exact Mass | 590.38 |
| IUPAC Name | (1R,2S,5S,6R,7R)-3-[2-(azepan-1-yl)ethyl]-2-N-[(1R,2S,3R)-2,3-dimethylcyclohexyl]-4-oxo-6-N-(4-propan-2-ylphenyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
| SMILES | CC(C)c1ccc(NC(=O)[C@H]2[C@H]3C=C[C@@]4(O3)[C@H]2C(=O)N(CCN2CCCCCC2)[C@@H]4C(=O)N[C@@H]2CCC[C@@H](C)[C@@H]2C)cc1 |
| InChI | InChI=1S/C35H50N4O4/c1-22(2)25-12-14-26(15-13-25)36-32(40)29-28-16-17-35(43-28)30(29)34(42)39(21-20-38-18-7-5-6-8-19-38)31(35)33(41)37-27-11-9-10-23(3)24(27)4/h12-17,22-24,27-31H,5-11,18-21H2,1-4H3,(H,36,40)(H,37,41)/t23-,24+,27-,28-,29+,30-,31-,35-/m1/s1 |
| InChIKey | OCZFXPMOBJEIGD-UGOLHSGVSA-N |
| XLogP | 4.72 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.81 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|