C32H43N3O5 — CID 87048992
(5S,7R)-2-N-(2,3-dimethylcyclohexyl)-4-oxo-3-(oxolan-2-ylmethyl)-6-N-(4-propan-2-ylphenyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide (PubChem CID 87048992) has the molecular formula C32H43N3O5 and a molecular weight of 549.71 g/mol. Its IUPAC name is (5S,7R)-2-N-(2,3-dimethylcyclohexyl)-4-oxo-3-(oxolan-2-ylmethyl)-6-N-(4-propan-2-ylphenyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide.
| Compound Name | (5S,7R)-2-N-(2,3-dimethylcyclohexyl)-4-oxo-3-(oxolan-2-ylmethyl)-6-N-(4-propan-2-ylphenyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 87048992 |
| Molecular Formula | C32H43N3O5 |
| Molecular Weight | 549.71 g/mol |
| Exact Mass | 549.32 |
| IUPAC Name | (5S,7R)-2-N-(2,3-dimethylcyclohexyl)-4-oxo-3-(oxolan-2-ylmethyl)-6-N-(4-propan-2-ylphenyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
| SMILES | CC(C)c1ccc(NC(=O)C2[C@H]3C=CC4(O3)C(C(=O)NC3CCCC(C)C3C)N(CC3CCCO3)C(=O)[C@@H]24)cc1 |
| InChI | InChI=1S/C32H43N3O5/c1-18(2)21-10-12-22(13-11-21)33-29(36)26-25-14-15-32(40-25)27(26)31(38)35(17-23-8-6-16-39-23)28(32)30(37)34-24-9-5-7-19(3)20(24)4/h10-15,18-20,23-28H,5-9,16-17H2,1-4H3,(H,33,36)(H,34,37)/t19?,20?,23?,24?,25-,26?,27-,28?,32?/m1/s1 |
| InChIKey | CYHJZHQELJRSDR-WHIQWEPJSA-N |
| XLogP | 4.02 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.71 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|