C29H36ClN3O5 — CID 129436531
(1S,2R,5S,6S,7R)-6-N-(3-chlorophenyl)-2-N-[(1S,2S,3R)-2,3-dimethylcyclohexyl]-4-oxo-3-[[(2S)-oxolan-2-yl]methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide (PubChem CID 129436531) has the molecular formula C29H36ClN3O5 and a molecular weight of 542.08 g/mol. Its IUPAC name is (1S,2R,5S,6S,7R)-6-N-(3-chlorophenyl)-2-N-[(1S,2S,3R)-2,3-dimethylcyclohexyl]-4-oxo-3-[[(2S)-oxolan-2-yl]methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide.
| Compound Name | (1S,2R,5S,6S,7R)-6-N-(3-chlorophenyl)-2-N-[(1S,2S,3R)-2,3-dimethylcyclohexyl]-4-oxo-3-[[(2S)-oxolan-2-yl]methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 129436531 |
| Molecular Formula | C29H36ClN3O5 |
| Molecular Weight | 542.08 g/mol |
| Exact Mass | 541.23 |
| IUPAC Name | (1S,2R,5S,6S,7R)-6-N-(3-chlorophenyl)-2-N-[(1S,2S,3R)-2,3-dimethylcyclohexyl]-4-oxo-3-[[(2S)-oxolan-2-yl]methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
| SMILES | C[C@H]1[C@H](C)CCC[C@@H]1NC(=O)[C@@H]1N(C[C@@H]2CCCO2)C(=O)[C@H]2[C@H](C(=O)Nc3cccc(Cl)c3)[C@H]3C=C[C@@]12O3 |
| InChI | InChI=1S/C29H36ClN3O5/c1-16-6-3-10-21(17(16)2)32-27(35)25-29-12-11-22(38-29)23(26(34)31-19-8-4-7-18(30)14-19)24(29)28(36)33(25)15-20-9-5-13-37-20/h4,7-8,11-12,14,16-17,20-25H,3,5-6,9-10,13,15H2,1-2H3,(H,31,34)(H,32,35)/t16-,17+,20+,21+,22-,23-,24-,25+,29+/m1/s1 |
| InChIKey | QAHPCSQTAZYROO-ARGVHORRSA-N |
| XLogP | 3.55 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.08 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|