C32H43N3O4 — CID 129436611
(1S,2R,5R,6S,7S)-3-cyclohexyl-2-N-[(1S,2S)-2-methylcyclohexyl]-4-oxo-6-N-(4-propan-2-ylphenyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide (PubChem CID 129436611) has the molecular formula C32H43N3O4 and a molecular weight of 533.71 g/mol. Its IUPAC name is (1S,2R,5R,6S,7S)-3-cyclohexyl-2-N-[(1S,2S)-2-methylcyclohexyl]-4-oxo-6-N-(4-propan-2-ylphenyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide.
| Compound Name | (1S,2R,5R,6S,7S)-3-cyclohexyl-2-N-[(1S,2S)-2-methylcyclohexyl]-4-oxo-6-N-(4-propan-2-ylphenyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 129436611 |
| Molecular Formula | C32H43N3O4 |
| Molecular Weight | 533.71 g/mol |
| Exact Mass | 533.33 |
| IUPAC Name | (1S,2R,5R,6S,7S)-3-cyclohexyl-2-N-[(1S,2S)-2-methylcyclohexyl]-4-oxo-6-N-(4-propan-2-ylphenyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
| SMILES | CC(C)c1ccc(NC(=O)[C@@H]2[C@@H]3C=C[C@]4(O3)[C@@H]2C(=O)N(C2CCCCC2)[C@H]4C(=O)N[C@H]2CCCC[C@@H]2C)cc1 |
| InChI | InChI=1S/C32H43N3O4/c1-19(2)21-13-15-22(16-14-21)33-29(36)26-25-17-18-32(39-25)27(26)31(38)35(23-10-5-4-6-11-23)28(32)30(37)34-24-12-8-7-9-20(24)3/h13-20,23-28H,4-12H2,1-3H3,(H,33,36)(H,34,37)/t20-,24-,25-,26+,27-,28-,32-/m0/s1 |
| InChIKey | QRQDEMRFMDPABK-OKFURQJPSA-N |
| XLogP | 4.93 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.71 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|