C32H41Cl2N3O4 — CID 87048680
(5R,7S)-3-cyclooctyl-6-N-(3,5-dichlorophenyl)-2-N-(2,3-dimethylcyclohexyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide (PubChem CID 87048680) has the molecular formula C32H41Cl2N3O4 and a molecular weight of 602.60 g/mol. Its IUPAC name is (5R,7S)-3-cyclooctyl-6-N-(3,5-dichlorophenyl)-2-N-(2,3-dimethylcyclohexyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide.
| Compound Name | (5R,7S)-3-cyclooctyl-6-N-(3,5-dichlorophenyl)-2-N-(2,3-dimethylcyclohexyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 87048680 |
| Molecular Formula | C32H41Cl2N3O4 |
| Molecular Weight | 602.60 g/mol |
| Exact Mass | 601.25 |
| IUPAC Name | (5R,7S)-3-cyclooctyl-6-N-(3,5-dichlorophenyl)-2-N-(2,3-dimethylcyclohexyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
| SMILES | CC1CCCC(NC(=O)C2N(C3CCCCCCC3)C(=O)[C@@H]3C(C(=O)Nc4cc(Cl)cc(Cl)c4)[C@@H]4C=CC23O4)C1C |
| InChI | InChI=1S/C32H41Cl2N3O4/c1-18-9-8-12-24(19(18)2)36-30(39)28-32-14-13-25(41-32)26(29(38)35-22-16-20(33)15-21(34)17-22)27(32)31(40)37(28)23-10-6-4-3-5-7-11-23/h13-19,23-28H,3-12H2,1-2H3,(H,35,38)(H,36,39)/t18?,19?,24?,25-,26?,27-,28?,32?/m0/s1 |
| InChIKey | CVHGIZVEJNWKHO-BNKBGZKDSA-N |
| XLogP | 6.14 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.60 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|