C20H27FN2O — CID 129439707
(1S,8R)-N-[1-(4-fluorophenyl)butylideneamino]bicyclo[6.1.0]nonane-9-carboxamide (PubChem CID 129439707) has the molecular formula C20H27FN2O and a molecular weight of 330.45 g/mol. Its IUPAC name is (1S,8R)-N-[1-(4-fluorophenyl)butylideneamino]bicyclo[6.1.0]nonane-9-carboxamide.
| Compound Name | (1S,8R)-N-[1-(4-fluorophenyl)butylideneamino]bicyclo[6.1.0]nonane-9-carboxamide |
|---|---|
| PubChem CID | 129439707 |
| Molecular Formula | C20H27FN2O |
| Molecular Weight | 330.45 g/mol |
| Exact Mass | 330.21 |
| IUPAC Name | (1S,8R)-N-[1-(4-fluorophenyl)butylideneamino]bicyclo[6.1.0]nonane-9-carboxamide |
| SMILES | CCCC(=NNC(=O)C1[C@H]2CCCCCC[C@@H]12)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H27FN2O/c1-2-7-18(14-10-12-15(21)13-11-14)22-23-20(24)19-16-8-5-3-4-6-9-17(16)19/h10-13,16-17,19H,2-9H2,1H3,(H,23,24)/t16-,17+,19? |
| InChIKey | NYWYBCDKBMENSU-JJTKIYQPSA-N |
| XLogP | 4.66 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.45 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|