C14H16N2O2 — CID 129440133
methyl (1R,3S,4R)-3-pyridin-3-yl-2-azabicyclo[2.2.2]oct-5-ene-2-carboxylate (PubChem CID 129440133) has the molecular formula C14H16N2O2 and a molecular weight of 244.29 g/mol. Its IUPAC name is methyl (1R,3S,4R)-3-pyridin-3-yl-2-azabicyclo[2.2.2]oct-5-ene-2-carboxylate.
| Compound Name | methyl (1R,3S,4R)-3-pyridin-3-yl-2-azabicyclo[2.2.2]oct-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 129440133 |
| Molecular Formula | C14H16N2O2 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | methyl (1R,3S,4R)-3-pyridin-3-yl-2-azabicyclo[2.2.2]oct-5-ene-2-carboxylate |
| SMILES | COC(=O)N1[C@H](c2cccnc2)[C@H]2C=C[C@H]1CC2 |
| InChI | InChI=1S/C14H16N2O2/c1-18-14(17)16-12-6-4-10(5-7-12)13(16)11-3-2-8-15-9-11/h2-4,6,8-10,12-13H,5,7H2,1H3/t10-,12-,13-/m0/s1 |
| InChIKey | QTHAYMCWTFFXIF-DRZSPHRISA-N |
| XLogP | 2.54 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|