C33H27N3O2S4 — CID 129440570
3-ethyl-5-[(2Z)-2-(3-ethyl-4,5-diphenyl-1,3-thiazol-2-ylidene)ethylidene]-2-(4-oxo-3-phenyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)-1,3-thiazolidin-4-one (PubChem CID 129440570) has the molecular formula C33H27N3O2S4 and a molecular weight of 625.87 g/mol. Its IUPAC name is 3-ethyl-5-[(2Z)-2-(3-ethyl-4,5-diphenyl-1,3-thiazol-2-ylidene)ethylidene]-2-(4-oxo-3-phenyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)-1,3-thiazolidin-4-one.
| Compound Name | 3-ethyl-5-[(2Z)-2-(3-ethyl-4,5-diphenyl-1,3-thiazol-2-ylidene)ethylidene]-2-(4-oxo-3-phenyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 129440570 |
| Molecular Formula | C33H27N3O2S4 |
| Molecular Weight | 625.87 g/mol |
| Exact Mass | 625.10 |
| IUPAC Name | 3-ethyl-5-[(2Z)-2-(3-ethyl-4,5-diphenyl-1,3-thiazol-2-ylidene)ethylidene]-2-(4-oxo-3-phenyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)-1,3-thiazolidin-4-one |
| SMILES | CCN1C(c2ccccc2)=C(c2ccccc2)S/C1=C\C=c1sc(=C2SC(=S)N(c3ccccc3)C2=O)n(CC)c1=O |
| InChI | InChI=1S/C33H27N3O2S4/c1-3-34-26(41-28(23-16-10-6-11-17-23)27(34)22-14-8-5-9-15-22)21-20-25-30(37)35(4-2)32(40-25)29-31(38)36(33(39)42-29)24-18-12-7-13-19-24/h5-21H,3-4H2,1-2H3/b25-20?,26-21-,32-29? |
| InChIKey | UFYAZGJJTUADEG-YBGMZJQTSA-N |
| XLogP | 6.32 |
| TPSA | 45.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.87 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|