C13H27NOS — CID 129445773
(3S)-N-[[(1S,2R)-2-methylcyclohexyl]methyl]-3-[(R)-methylsulfinyl]butan-1-amine (PubChem CID 129445773) has the molecular formula C13H27NOS and a molecular weight of 245.43 g/mol. Its IUPAC name is (3S)-N-[[(1S,2R)-2-methylcyclohexyl]methyl]-3-[(R)-methylsulfinyl]butan-1-amine.
| Compound Name | (3S)-N-[[(1S,2R)-2-methylcyclohexyl]methyl]-3-[(R)-methylsulfinyl]butan-1-amine |
|---|---|
| PubChem CID | 129445773 |
| Molecular Formula | C13H27NOS |
| Molecular Weight | 245.43 g/mol |
| Exact Mass | 245.18 |
| IUPAC Name | (3S)-N-[[(1S,2R)-2-methylcyclohexyl]methyl]-3-[(R)-methylsulfinyl]butan-1-amine |
| SMILES | C[C@@H]1CCCC[C@@H]1CNCC[C@H](C)[S@@](C)=O |
| InChI | InChI=1S/C13H27NOS/c1-11-6-4-5-7-13(11)10-14-9-8-12(2)16(3)15/h11-14H,4-10H2,1-3H3/t11-,12+,13-,16-/m1/s1 |
| InChIKey | AQZKKLMLDCRYCP-OQMKEHIESA-N |
| XLogP | 2.56 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.43 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|