C12H20F3NO2 — CID 129445965
(2S)-1-[(2S)-2-[(1S)-2,2,2-trifluoro-1-hydroxyethyl]pyrrolidin-1-yl]hex-5-en-2-ol (PubChem CID 129445965) has the molecular formula C12H20F3NO2 and a molecular weight of 267.29 g/mol. Its IUPAC name is (2S)-1-[(2S)-2-[(1S)-2,2,2-trifluoro-1-hydroxyethyl]pyrrolidin-1-yl]hex-5-en-2-ol.
| Compound Name | (2S)-1-[(2S)-2-[(1S)-2,2,2-trifluoro-1-hydroxyethyl]pyrrolidin-1-yl]hex-5-en-2-ol |
|---|---|
| PubChem CID | 129445965 |
| Molecular Formula | C12H20F3NO2 |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | (2S)-1-[(2S)-2-[(1S)-2,2,2-trifluoro-1-hydroxyethyl]pyrrolidin-1-yl]hex-5-en-2-ol |
| SMILES | C=CCC[C@H](O)CN1CCC[C@H]1[C@H](O)C(F)(F)F |
| InChI | InChI=1S/C12H20F3NO2/c1-2-3-5-9(17)8-16-7-4-6-10(16)11(18)12(13,14)15/h2,9-11,17-18H,1,3-8H2/t9-,10-,11-/m0/s1 |
| InChIKey | GUPZGKPEHQJPOC-DCAQKATOSA-N |
| XLogP | 1.70 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|