C30H46O4 — CID 129447949
(1R,2S,5S,7S,10R,11R,15R,17R,20R,21R,22S)-7,21-dihydroxy-1,2,6,6,10,17,22-heptamethyl-19-oxahexacyclo[12.10.0.02,11.05,10.015,22.017,20]tetracos-13-en-18-one (PubChem CID 129447949) has the molecular formula C30H46O4 and a molecular weight of 470.69 g/mol. Its IUPAC name is (1R,2S,5S,7S,10R,11R,15R,17R,20R,21R,22S)-7,21-dihydroxy-1,2,6,6,10,17,22-heptamethyl-19-oxahexacyclo[12.10.0.02,11.05,10.015,22.017,20]tetracos-13-en-18-one.
| Compound Name | (1R,2S,5S,7S,10R,11R,15R,17R,20R,21R,22S)-7,21-dihydroxy-1,2,6,6,10,17,22-heptamethyl-19-oxahexacyclo[12.10.0.02,11.05,10.015,22.017,20]tetracos-13-en-18-one |
|---|---|
| PubChem CID | 129447949 |
| Molecular Formula | C30H46O4 |
| Molecular Weight | 470.69 g/mol |
| Exact Mass | 470.34 |
| IUPAC Name | (1R,2S,5S,7S,10R,11R,15R,17R,20R,21R,22S)-7,21-dihydroxy-1,2,6,6,10,17,22-heptamethyl-19-oxahexacyclo[12.10.0.02,11.05,10.015,22.017,20]tetracos-13-en-18-one |
| SMILES | CC1(C)[C@H]2CC[C@@]3(C)[C@H](CC=C4[C@H]5C[C@@]6(C)C(=O)O[C@H]6[C@H](O)[C@@]5(C)CC[C@@]43C)[C@@]2(C)CC[C@@H]1O |
| InChI | InChI=1S/C30H46O4/c1-25(2)19-10-13-30(7)20(27(19,4)12-11-21(25)31)9-8-17-18-16-28(5)23(34-24(28)33)22(32)26(18,3)14-15-29(17,30)6/h8,18-23,31-32H,9-16H2,1-7H3/t18-,19-,20-,21+,22+,23+,26+,27+,28-,29+,30+/m1/s1 |
| InChIKey | HPCKTSQVFAOGNN-GNCHWUNESA-N |
| XLogP | 5.66 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.69 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'four_member_lactones', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|