C32H48O5 — CID 171319528
[(1S,2R,5R,7S,10R,11R,15S,17R,21R,22R)-21-hydroxy-1,2,6,6,10,17,22-heptamethyl-18-oxo-19-oxahexacyclo[12.10.0.02,11.05,10.015,22.017,20]tetracos-13-en-7-yl] acetate (PubChem CID 171319528) has the molecular formula C32H48O5 and a molecular weight of 512.73 g/mol. Its IUPAC name is [(1S,2R,5R,7S,10R,11R,15S,17R,21R,22R)-21-hydroxy-1,2,6,6,10,17,22-heptamethyl-18-oxo-19-oxahexacyclo[12.10.0.02,11.05,10.015,22.017,20]tetracos-13-en-7-yl] acetate.
| Compound Name | [(1S,2R,5R,7S,10R,11R,15S,17R,21R,22R)-21-hydroxy-1,2,6,6,10,17,22-heptamethyl-18-oxo-19-oxahexacyclo[12.10.0.02,11.05,10.015,22.017,20]tetracos-13-en-7-yl] acetate |
|---|---|
| PubChem CID | 171319528 |
| Molecular Formula | C32H48O5 |
| Molecular Weight | 512.73 g/mol |
| Exact Mass | 512.35 |
| IUPAC Name | [(1S,2R,5R,7S,10R,11R,15S,17R,21R,22R)-21-hydroxy-1,2,6,6,10,17,22-heptamethyl-18-oxo-19-oxahexacyclo[12.10.0.02,11.05,10.015,22.017,20]tetracos-13-en-7-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC[C@]2(C)[C@H]3CC=C4[C@@H]5C[C@@]6(C)C(=O)OC6[C@H](O)[C@]5(C)CC[C@@]4(C)[C@]3(C)CC[C@H]2C1(C)C |
| InChI | InChI=1S/C32H48O5/c1-18(33)36-23-12-13-29(5)21(27(23,2)3)11-14-32(8)22(29)10-9-19-20-17-30(6)25(37-26(30)35)24(34)28(20,4)15-16-31(19,32)7/h9,20-25,34H,10-17H2,1-8H3/t20-,21-,22+,23-,24-,25?,28+,29-,30+,31+,32+/m0/s1 |
| InChIKey | WNRCJBQOZGWMQX-RDWSZGJGSA-N |
| XLogP | 6.23 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.73 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'four_member_lactones', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|