C25H36N2O3 — CID 129448198
ethyl N-[[(8S,9R,10S,13S,14R,17S)-17-acetyl-10,13,17-trimethyl-2,8,9,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-3-ylidene]amino]carbamate (PubChem CID 129448198) has the molecular formula C25H36N2O3 and a molecular weight of 412.57 g/mol. Its IUPAC name is ethyl N-[[(8S,9R,10S,13S,14R,17S)-17-acetyl-10,13,17-trimethyl-2,8,9,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-3-ylidene]amino]carbamate.
| Compound Name | ethyl N-[[(8S,9R,10S,13S,14R,17S)-17-acetyl-10,13,17-trimethyl-2,8,9,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-3-ylidene]amino]carbamate |
|---|---|
| PubChem CID | 129448198 |
| Molecular Formula | C25H36N2O3 |
| Molecular Weight | 412.57 g/mol |
| Exact Mass | 412.27 |
| IUPAC Name | ethyl N-[[(8S,9R,10S,13S,14R,17S)-17-acetyl-10,13,17-trimethyl-2,8,9,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-3-ylidene]amino]carbamate |
| SMILES | CCOC(=O)NN=C1C=C2C=C[C@@H]3[C@H]4CC[C@](C)(C(C)=O)[C@@]4(C)CC[C@H]3[C@]2(C)CC1 |
| InChI | InChI=1S/C25H36N2O3/c1-6-30-22(29)27-26-18-9-12-23(3)17(15-18)7-8-19-20(23)10-14-25(5)21(19)11-13-24(25,4)16(2)28/h7-8,15,19-21H,6,9-14H2,1-5H3,(H,27,29)/t19-,20+,21+,23+,24+,25-/m0/s1 |
| InChIKey | GPTJJNOQYVGRQV-ACSXSLCXSA-N |
| XLogP | 5.42 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.57 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|