C21H32N4O — CID 17376390
(3Z,10R,13S,17R)-17-ethanehydrazonoyl-3-hydrazinylidene-10,13-dimethyl-2,8,9,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-17-ol (PubChem CID 17376390) has the molecular formula C21H32N4O and a molecular weight of 356.51 g/mol. Its IUPAC name is (3Z,10R,13S,17R)-17-ethanehydrazonoyl-3-hydrazinylidene-10,13-dimethyl-2,8,9,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-17-ol.
| Compound Name | (3Z,10R,13S,17R)-17-ethanehydrazonoyl-3-hydrazinylidene-10,13-dimethyl-2,8,9,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-17-ol |
|---|---|
| PubChem CID | 17376390 |
| Molecular Formula | C21H32N4O |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.26 |
| IUPAC Name | (3Z,10R,13S,17R)-17-ethanehydrazonoyl-3-hydrazinylidene-10,13-dimethyl-2,8,9,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-17-ol |
| SMILES | C/C(=N\N)[C@@]1(O)CCC2C3C=CC4=C/C(=N\N)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C21H32N4O/c1-13(24-22)21(26)11-8-18-16-5-4-14-12-15(25-23)6-9-19(14,2)17(16)7-10-20(18,21)3/h4-5,12,16-18,26H,6-11,22-23H2,1-3H3/b24-13+,25-15-/t16?,17?,18?,19-,20-,21-/m0/s1 |
| InChIKey | GUIUGRNHIOQLSU-LKENJIFLSA-N |
| XLogP | 3.11 |
| TPSA | 96.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|