C28H42O6 — CID 129448903
methyl (3R)-3-[(3R,5R,9S,10S,12S,13R,17S)-3,12-diacetyloxy-10,13-dimethyl-2,3,4,5,6,7,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]butanoate (PubChem CID 129448903) has the molecular formula C28H42O6 and a molecular weight of 474.64 g/mol. Its IUPAC name is methyl (3R)-3-[(3R,5R,9S,10S,12S,13R,17S)-3,12-diacetyloxy-10,13-dimethyl-2,3,4,5,6,7,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]butanoate.
| Compound Name | methyl (3R)-3-[(3R,5R,9S,10S,12S,13R,17S)-3,12-diacetyloxy-10,13-dimethyl-2,3,4,5,6,7,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]butanoate |
|---|---|
| PubChem CID | 129448903 |
| Molecular Formula | C28H42O6 |
| Molecular Weight | 474.64 g/mol |
| Exact Mass | 474.30 |
| IUPAC Name | methyl (3R)-3-[(3R,5R,9S,10S,12S,13R,17S)-3,12-diacetyloxy-10,13-dimethyl-2,3,4,5,6,7,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]butanoate |
| SMILES | COC(=O)C[C@@H](C)[C@@H]1CCC2=C3CC[C@@H]4C[C@H](OC(C)=O)CC[C@]4(C)[C@@H]3C[C@H](OC(C)=O)[C@@]21C |
| InChI | InChI=1S/C28H42O6/c1-16(13-26(31)32-6)22-9-10-23-21-8-7-19-14-20(33-17(2)29)11-12-27(19,4)24(21)15-25(28(22,23)5)34-18(3)30/h16,19-20,22,24-25H,7-15H2,1-6H3/t16-,19-,20-,22+,24-,25+,27+,28-/m1/s1 |
| InChIKey | QKNHNHZJMQSAHF-USKQFBCOSA-N |
| XLogP | 5.38 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.64 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|