C30H46O7 — CID 126749512
methyl (3R)-3-[(3R,5S,6R,7R,8R,9S,10S,13R,14S,17R)-3,7-diacetyloxy-6-ethyl-10,13-dimethyl-12-oxo-1,2,3,4,5,6,7,8,9,11,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]butanoate (PubChem CID 126749512) has the molecular formula C30H46O7 and a molecular weight of 518.69 g/mol. Its IUPAC name is methyl (3R)-3-[(3R,5S,6R,7R,8R,9S,10S,13R,14S,17R)-3,7-diacetyloxy-6-ethyl-10,13-dimethyl-12-oxo-1,2,3,4,5,6,7,8,9,11,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]butanoate.
| Compound Name | methyl (3R)-3-[(3R,5S,6R,7R,8R,9S,10S,13R,14S,17R)-3,7-diacetyloxy-6-ethyl-10,13-dimethyl-12-oxo-1,2,3,4,5,6,7,8,9,11,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]butanoate |
|---|---|
| PubChem CID | 126749512 |
| Molecular Formula | C30H46O7 |
| Molecular Weight | 518.69 g/mol |
| Exact Mass | 518.32 |
| IUPAC Name | methyl (3R)-3-[(3R,5S,6R,7R,8R,9S,10S,13R,14S,17R)-3,7-diacetyloxy-6-ethyl-10,13-dimethyl-12-oxo-1,2,3,4,5,6,7,8,9,11,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]butanoate |
| SMILES | CC[C@H]1[C@@H](OC(C)=O)[C@@H]2[C@H](CC(=O)[C@]3(C)[C@@H]([C@H](C)CC(=O)OC)CC[C@@H]23)[C@@]2(C)CC[C@@H](OC(C)=O)C[C@@H]12 |
| InChI | InChI=1S/C30H46O7/c1-8-20-23-14-19(36-17(3)31)11-12-29(23,5)24-15-25(33)30(6)21(16(2)13-26(34)35-7)9-10-22(30)27(24)28(20)37-18(4)32/h16,19-24,27-28H,8-15H2,1-7H3/t16-,19-,20-,21-,22+,23+,24+,27+,28-,29+,30-/m1/s1 |
| InChIKey | CSEHCGLBKXCTHV-OOLWJRKTSA-N |
| XLogP | 5.13 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.69 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|