C30H46O7 — CID 129023313
methyl (3R)-3-[(4S,5R,6R,11R,12R,13S,15R,18S)-11,15-diacetyloxy-12-ethyl-5,18-dimethyl-3-oxapentacyclo[8.8.0.02,4.05,9.013,18]octadecan-6-yl]butanoate (PubChem CID 129023313) has the molecular formula C30H46O7 and a molecular weight of 518.69 g/mol. Its IUPAC name is methyl (3R)-3-[(4S,5R,6R,11R,12R,13S,15R,18S)-11,15-diacetyloxy-12-ethyl-5,18-dimethyl-3-oxapentacyclo[8.8.0.02,4.05,9.013,18]octadecan-6-yl]butanoate.
| Compound Name | methyl (3R)-3-[(4S,5R,6R,11R,12R,13S,15R,18S)-11,15-diacetyloxy-12-ethyl-5,18-dimethyl-3-oxapentacyclo[8.8.0.02,4.05,9.013,18]octadecan-6-yl]butanoate |
|---|---|
| PubChem CID | 129023313 |
| Molecular Formula | C30H46O7 |
| Molecular Weight | 518.69 g/mol |
| Exact Mass | 518.32 |
| IUPAC Name | methyl (3R)-3-[(4S,5R,6R,11R,12R,13S,15R,18S)-11,15-diacetyloxy-12-ethyl-5,18-dimethyl-3-oxapentacyclo[8.8.0.02,4.05,9.013,18]octadecan-6-yl]butanoate |
| SMILES | CC[C@H]1C(OC(C)=O)C2C3CC[C@H]([C@H](C)CC(=O)OC)[C@@]3(C)[C@@H]3OC3C2[C@@]2(C)CC[C@@H](OC(C)=O)C[C@@H]12 |
| InChI | InChI=1S/C30H46O7/c1-8-19-22-14-18(35-16(3)31)11-12-29(22,5)25-24(26(19)36-17(4)32)21-10-9-20(15(2)13-23(33)34-7)30(21,6)28-27(25)37-28/h15,18-22,24-28H,8-14H2,1-7H3/t15-,18-,19-,20-,21?,22+,24?,25?,26?,27?,28-,29+,30-/m1/s1 |
| InChIKey | NGTFXFLOIWWHKU-YXUCUNKCSA-N |
| XLogP | 4.94 |
| TPSA | 91.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.69 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|