C27H42O5 — CID 45044689
methyl 4-[(2S,4R,15R)-15-acetyloxy-5,18-dimethyl-3-oxapentacyclo[8.8.0.02,4.05,9.013,18]octadecan-6-yl]pentanoate (PubChem CID 45044689) has the molecular formula C27H42O5 and a molecular weight of 446.63 g/mol. Its IUPAC name is methyl 4-[(2S,4R,15R)-15-acetyloxy-5,18-dimethyl-3-oxapentacyclo[8.8.0.02,4.05,9.013,18]octadecan-6-yl]pentanoate.
| Compound Name | methyl 4-[(2S,4R,15R)-15-acetyloxy-5,18-dimethyl-3-oxapentacyclo[8.8.0.02,4.05,9.013,18]octadecan-6-yl]pentanoate |
|---|---|
| PubChem CID | 45044689 |
| Molecular Formula | C27H42O5 |
| Molecular Weight | 446.63 g/mol |
| Exact Mass | 446.30 |
| IUPAC Name | methyl 4-[(2S,4R,15R)-15-acetyloxy-5,18-dimethyl-3-oxapentacyclo[8.8.0.02,4.05,9.013,18]octadecan-6-yl]pentanoate |
| SMILES | COC(=O)CCC(C)C1CCC2C3CCC4C[C@H](OC(C)=O)CCC4(C)C3[C@@H]3O[C@@H]3C12C |
| InChI | InChI=1S/C27H42O5/c1-15(6-11-22(29)30-5)20-9-10-21-19-8-7-17-14-18(31-16(2)28)12-13-26(17,3)23(19)24-25(32-24)27(20,21)4/h15,17-21,23-25H,6-14H2,1-5H3/t15?,17?,18-,19?,20?,21?,23?,24+,25+,26?,27?/m1/s1 |
| InChIKey | CYPQELKXBYBDOE-JZDYZZIPSA-N |
| XLogP | 5.15 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.63 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|