C25H40O3 — CID 125029398
methyl (4S)-4-[(1R,2R,4S,5S,6S,9R,10R,13R,18S)-5,18-dimethyl-3-oxapentacyclo[8.8.0.02,4.05,9.013,18]octadecan-6-yl]pentanoate (PubChem CID 125029398) has the molecular formula C25H40O3 and a molecular weight of 388.59 g/mol. Its IUPAC name is methyl (4S)-4-[(1R,2R,4S,5S,6S,9R,10R,13R,18S)-5,18-dimethyl-3-oxapentacyclo[8.8.0.02,4.05,9.013,18]octadecan-6-yl]pentanoate.
| Compound Name | methyl (4S)-4-[(1R,2R,4S,5S,6S,9R,10R,13R,18S)-5,18-dimethyl-3-oxapentacyclo[8.8.0.02,4.05,9.013,18]octadecan-6-yl]pentanoate |
|---|---|
| PubChem CID | 125029398 |
| Molecular Formula | C25H40O3 |
| Molecular Weight | 388.59 g/mol |
| Exact Mass | 388.30 |
| IUPAC Name | methyl (4S)-4-[(1R,2R,4S,5S,6S,9R,10R,13R,18S)-5,18-dimethyl-3-oxapentacyclo[8.8.0.02,4.05,9.013,18]octadecan-6-yl]pentanoate |
| SMILES | COC(=O)CC[C@H](C)[C@@H]1CC[C@@H]2[C@H]3CC[C@H]4CCCC[C@]4(C)[C@@H]3[C@H]3O[C@H]3[C@]21C |
| InChI | InChI=1S/C25H40O3/c1-15(8-13-20(26)27-4)18-11-12-19-17-10-9-16-7-5-6-14-24(16,2)21(17)22-23(28-22)25(18,19)3/h15-19,21-23H,5-14H2,1-4H3/t15-,16+,17+,18-,19+,21-,22+,23+,24-,25-/m0/s1 |
| InChIKey | FXRYPRSTXONWAP-DNELJRJFSA-N |
| XLogP | 5.61 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.59 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|